2-Methyl-3-benzoylpropionic acid

2-Methyl-3-benzoylpropionic acid - Names and Identifiers

Name	2-methyl-4-oxo-4-phenylbutyric acid
Synonyms	2-Methyl-3-benzoylpropionic acid α-Methyl-γ-oxobenzenebutyric acid 2-METHYL-4-OXO-4-PHENYLBUTYRIC ACID 2-methyl-4-oxo-4-phenylbutyric acid 2-methyl-4-oxo-4-phenylbutanoic acid 2-methyl-4-oxo-4-phenyl-butanoic acid Benzenebutanoic acid, α-methyl-γ-oxo- 4-keto-2-methyl-4-phenyl-butyric acid
CAS	1771-65-9
InChI	InChI=1/C11H12O3/c1-8(11(13)14)7-10(12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,13,14)

2-Methyl-3-benzoylpropionic acid - Physico-chemical Properties

Molecular Formula	C11H12O3
Molar Mass	192.21
Density	1.161±0.06 g/cm3(Predicted)
Melting Point	140-142°C(lit.)
Boling Point	360.9±25.0 °C(Predicted)
Flash Point	186.3°C
Solubility	DMSO (Slightly), Methanol (Slightly)
Vapor Presure	7.71E-06mmHg at 25°C
Appearance	Solid
Color	White to Off-White
pKa	4.57±0.23(Predicted)
Storage Condition	Refrigerator
Refractive Index	1.537

2-Methyl-3-benzoylpropionic acid - Risk and Safety

WGK Germany

2-Methyl-3-benzoylpropionic acid - Introduction

The acid, also known as MOPBA, is an organic compound. The following is a description of the properties, uses, preparation and safety information of the compound:

Nature:
1. MOPBA is a solid, usually white crystal or crystal powder.
2. It is insoluble in water at room temperature, but soluble in organic solvents, such as ethanol and dimethylformamide.
3. MOPBA has relatively high thermal stability.

Use:
1. MOPBA is often used as a transition metal ligand, especially in catalytic reactions in the field of organic synthesis.
2. It can be used to synthesize various organic molecules, such as symmetrical and asymmetrical organic acids, and other organic compounds.

Method:
There are usually several methods that can be used to synthesize MOPBA, one of which is a common method by reacting benzoic acid with oxygen. The specific operation process can refer to the organic chemistry laboratory manual or literature.

Safety Information:
1. MOPBA is generally relatively safe under regular operating conditions, such as protective gloves, goggles and laboratory ventilation systems. However, as a chemical, it still needs to be handled and stored properly to avoid contact with other organic compounds and strong oxidants.
3. When using or handling, please refer to the relevant safety data sheet and instruction manual for more detailed safety information.

Last Update：2024-04-09 02:00:43